C5H8O2S — CID 175925578
1-[(5R)-1,3-oxathiolan-5-yl]ethanone (PubChem CID 175925578) has the molecular formula C5H8O2S and a molecular weight of 132.18 g/mol. Its IUPAC name is 1-[(5R)-1,3-oxathiolan-5-yl]ethanone.
| Compound Name | 1-[(5R)-1,3-oxathiolan-5-yl]ethanone |
|---|---|
| PubChem CID | 175925578 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 1-[(5R)-1,3-oxathiolan-5-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CSCO1 |
| InChI | InChI=1S/C5H8O2S/c1-4(6)5-2-8-3-7-5/h5H,2-3H2,1H3/t5-/m0/s1 |
| InChIKey | VLVAGBVEXLSLPX-YFKPBYRVSA-N |
| XLogP | 0.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |