C6H10O3S — CID 134936972
1-[(2S)-2-methyl-3-oxo-1,3-oxathiolan-2-yl]ethanone (PubChem CID 134936972) has the molecular formula C6H10O3S and a molecular weight of 162.21 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-3-oxo-1,3-oxathiolan-2-yl]ethanone.
| Compound Name | 1-[(2S)-2-methyl-3-oxo-1,3-oxathiolan-2-yl]ethanone |
|---|---|
| PubChem CID | 134936972 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1-[(2S)-2-methyl-3-oxo-1,3-oxathiolan-2-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)OCCS1=O |
| InChI | InChI=1S/C6H10O3S/c1-5(7)6(2)9-3-4-10(6)8/h3-4H2,1-2H3/t6-,10?/m0/s1 |
| InChIKey | HQZZNTARTHBRSJ-UOQJWNSWSA-N |
| XLogP | 0.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |