C12H20N4O4S — CID 103302124
[4-[(3-hydrazinyl-2-pyridinyl)sulfonyl]-6,6-dimethylmorpholin-2-yl]methanol (PubChem CID 103302124) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is [4-[(3-hydrazinyl-2-pyridinyl)sulfonyl]-6,6-dimethylmorpholin-2-yl]methanol.
| Compound Name | [4-[(3-hydrazinyl-2-pyridinyl)sulfonyl]-6,6-dimethylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 103302124 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [4-[(3-hydrazinyl-2-pyridinyl)sulfonyl]-6,6-dimethylmorpholin-2-yl]methanol |
| SMILES | CC1(C)CN(S(=O)(=O)c2ncccc2NN)CC(CO)O1 |
| InChI | InChI=1S/C12H20N4O4S/c1-12(2)8-16(6-9(7-17)20-12)21(18,19)11-10(15-13)4-3-5-14-11/h3-5,9,15,17H,6-8,13H2,1-2H3 |
| InChIKey | NQOHGUCPJPEFAR-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|