C16H15BrF3N — CID 103302512
N-[(3-bromo-2-methylphenyl)-(2,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 103302512) has the molecular formula C16H15BrF3N and a molecular weight of 358.20 g/mol. Its IUPAC name is N-[(3-bromo-2-methylphenyl)-(2,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-2-methylphenyl)-(2,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103302512 |
| Molecular Formula | C16H15BrF3N |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-[(3-bromo-2-methylphenyl)-(2,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(F)c(F)cc1F)c1cccc(Br)c1C |
| InChI | InChI=1S/C16H15BrF3N/c1-3-21-16(10-5-4-6-12(17)9(10)2)11-7-14(19)15(20)8-13(11)18/h4-8,16,21H,3H2,1-2H3 |
| InChIKey | MKSMMGIJKSPQEM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|