C10H13FN4O3S — CID 103302905
2-cyclopropyl-2-[(3-fluoro-2-pyridinyl)sulfonylamino]-N'-hydroxyethanimidamide (PubChem CID 103302905) has the molecular formula C10H13FN4O3S and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(3-fluoro-2-pyridinyl)sulfonylamino]-N'-hydroxyethanimidamide.
| Compound Name | 2-cyclopropyl-2-[(3-fluoro-2-pyridinyl)sulfonylamino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 103302905 |
| Molecular Formula | C10H13FN4O3S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-cyclopropyl-2-[(3-fluoro-2-pyridinyl)sulfonylamino]-N'-hydroxyethanimidamide |
| SMILES | N/C(=N/O)C(NS(=O)(=O)c1ncccc1F)C1CC1 |
| InChI | InChI=1S/C10H13FN4O3S/c11-7-2-1-5-13-10(7)19(17,18)15-8(6-3-4-6)9(12)14-16/h1-2,5-6,8,15-16H,3-4H2,(H2,12,14) |
| InChIKey | IREKZHWBOUBMQC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|