C10H14F3N3O2S — CID 103305039
3-amino-N-propyl-N-(2,2,2-trifluoroethyl)pyridine-2-sulfonamide (PubChem CID 103305039) has the molecular formula C10H14F3N3O2S and a molecular weight of 297.30 g/mol. Its IUPAC name is 3-amino-N-propyl-N-(2,2,2-trifluoroethyl)pyridine-2-sulfonamide.
| Compound Name | 3-amino-N-propyl-N-(2,2,2-trifluoroethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103305039 |
| Molecular Formula | C10H14F3N3O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-amino-N-propyl-N-(2,2,2-trifluoroethyl)pyridine-2-sulfonamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)c1ncccc1N |
| InChI | InChI=1S/C10H14F3N3O2S/c1-2-6-16(7-10(11,12)13)19(17,18)9-8(14)4-3-5-15-9/h3-5H,2,6-7,14H2,1H3 |
| InChIKey | RWXRHGRZOBKMBZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |