C9H12N2O4S — CID 103308429
5-(aminomethyl)-N-cyclopropylsulfonylfuran-2-carboxamide (PubChem CID 103308429) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 5-(aminomethyl)-N-cyclopropylsulfonylfuran-2-carboxamide.
| Compound Name | 5-(aminomethyl)-N-cyclopropylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 103308429 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-(aminomethyl)-N-cyclopropylsulfonylfuran-2-carboxamide |
| SMILES | NCc1ccc(C(=O)NS(=O)(=O)C2CC2)o1 |
| InChI | InChI=1S/C9H12N2O4S/c10-5-6-1-4-8(15-6)9(12)11-16(13,14)7-2-3-7/h1,4,7H,2-3,5,10H2,(H,11,12) |
| InChIKey | LIEJELRRDYKBIT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |