C12H20N2O2 — CID 103811384
5-(aminomethyl)-N-(3-methylpentan-3-yl)furan-2-carboxamide (PubChem CID 103811384) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(3-methylpentan-3-yl)furan-2-carboxamide.
| Compound Name | 5-(aminomethyl)-N-(3-methylpentan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 103811384 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 5-(aminomethyl)-N-(3-methylpentan-3-yl)furan-2-carboxamide |
| SMILES | CCC(C)(CC)NC(=O)c1ccc(CN)o1 |
| InChI | InChI=1S/C12H20N2O2/c1-4-12(3,5-2)14-11(15)10-7-6-9(8-13)16-10/h6-7H,4-5,8,13H2,1-3H3,(H,14,15) |
| InChIKey | HEXRFGOWGHAAPV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |