C13H21NO2 — CID 70989839
N-tert-butyl-5-butylfuran-2-carboxamide (PubChem CID 70989839) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-tert-butyl-5-butylfuran-2-carboxamide.
| Compound Name | N-tert-butyl-5-butylfuran-2-carboxamide |
|---|---|
| PubChem CID | 70989839 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-tert-butyl-5-butylfuran-2-carboxamide |
| SMILES | CCCCc1ccc(C(=O)NC(C)(C)C)o1 |
| InChI | InChI=1S/C13H21NO2/c1-5-6-7-10-8-9-11(16-10)12(15)14-13(2,3)4/h8-9H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | FLKCBTAGVJUUET-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |