C11H20N2O3S — CID 103308551
2-(1-aminocyclohexyl)-N-cyclopropylsulfonylacetamide (PubChem CID 103308551) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-(1-aminocyclohexyl)-N-cyclopropylsulfonylacetamide.
| Compound Name | 2-(1-aminocyclohexyl)-N-cyclopropylsulfonylacetamide |
|---|---|
| PubChem CID | 103308551 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-(1-aminocyclohexyl)-N-cyclopropylsulfonylacetamide |
| SMILES | NC1(CC(=O)NS(=O)(=O)C2CC2)CCCCC1 |
| InChI | InChI=1S/C11H20N2O3S/c12-11(6-2-1-3-7-11)8-10(14)13-17(15,16)9-4-5-9/h9H,1-8,12H2,(H,13,14) |
| InChIKey | UPJNFVWTFHBKOZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |