C13H26N2O3S — CID 62047541
N-[(1-aminocycloheptyl)methyl]oxane-4-sulfonamide (PubChem CID 62047541) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is N-[(1-aminocycloheptyl)methyl]oxane-4-sulfonamide.
| Compound Name | N-[(1-aminocycloheptyl)methyl]oxane-4-sulfonamide |
|---|---|
| PubChem CID | 62047541 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-[(1-aminocycloheptyl)methyl]oxane-4-sulfonamide |
| SMILES | NC1(CNS(=O)(=O)C2CCOCC2)CCCCCC1 |
| InChI | InChI=1S/C13H26N2O3S/c14-13(7-3-1-2-4-8-13)11-15-19(16,17)12-5-9-18-10-6-12/h12,15H,1-11,14H2 |
| InChIKey | PQEQAFPCIVIZNQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |