C8H19ClN2O2S — CID 119958900
N-[(1-aminocyclohexyl)methyl]methanesulfonamide;hydrochloride (PubChem CID 119958900) has the molecular formula C8H19ClN2O2S and a molecular weight of 242.77 g/mol. Its IUPAC name is N-[(1-aminocyclohexyl)methyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[(1-aminocyclohexyl)methyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119958900 |
| Molecular Formula | C8H19ClN2O2S |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[(1-aminocyclohexyl)methyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)NCC1(N)CCCCC1.Cl |
| InChI | InChI=1S/C8H18N2O2S.ClH/c1-13(11,12)10-7-8(9)5-3-2-4-6-8;/h10H,2-7,9H2,1H3;1H |
| InChIKey | ARUZUTWJUSGECE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |