C10H13F6NO2 — CID 103310130
3,3,3-trifluoro-N-[2-(2-methylprop-2-enoxy)ethyl]-2-(trifluoromethyl)propanamide (PubChem CID 103310130) has the molecular formula C10H13F6NO2 and a molecular weight of 293.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[2-(2-methylprop-2-enoxy)ethyl]-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-[2-(2-methylprop-2-enoxy)ethyl]-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103310130 |
| Molecular Formula | C10H13F6NO2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3,3,3-trifluoro-N-[2-(2-methylprop-2-enoxy)ethyl]-2-(trifluoromethyl)propanamide |
| SMILES | C=C(C)COCCNC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6NO2/c1-6(2)5-19-4-3-17-8(18)7(9(11,12)13)10(14,15)16/h7H,1,3-5H2,2H3,(H,17,18) |
| InChIKey | PFYSDBPHFVPFKH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|