C10H12F6N2O — CID 103311182
N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]propan-2-amine (PubChem CID 103311182) has the molecular formula C10H12F6N2O and a molecular weight of 290.21 g/mol. Its IUPAC name is N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 103311182 |
| Molecular Formula | C10H12F6N2O |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ncc(C(C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C10H12F6N2O/c1-5(2)17-4-7-18-3-6(19-7)8(9(11,12)13)10(14,15)16/h3,5,8,17H,4H2,1-2H3 |
| InChIKey | UOXBNZJFMIVYQS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |