C10H12F6N2O2 — CID 103311186
N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 103311186) has the molecular formula C10H12F6N2O2 and a molecular weight of 306.21 g/mol. Its IUPAC name is N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 103311186 |
| Molecular Formula | C10H12F6N2O2 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-[[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-oxazol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ncc(C(C(F)(F)F)C(F)(F)F)o1 |
| InChI | InChI=1S/C10H12F6N2O2/c1-19-3-2-17-5-7-18-4-6(20-7)8(9(11,12)13)10(14,15)16/h4,8,17H,2-3,5H2,1H3 |
| InChIKey | SYNKPQLZWBUUTE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|