C9H12F3NO — CID 56987972
2-tert-butyl-5-(2,2,2-trifluoroethyl)-1,3-oxazole (PubChem CID 56987972) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,2,2-trifluoroethyl)-1,3-oxazole.
| Compound Name | 2-tert-butyl-5-(2,2,2-trifluoroethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 56987972 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-tert-butyl-5-(2,2,2-trifluoroethyl)-1,3-oxazole |
| SMILES | CC(C)(C)c1ncc(CC(F)(F)F)o1 |
| InChI | InChI=1S/C9H12F3NO/c1-8(2,3)7-13-5-6(14-7)4-9(10,11)12/h5H,4H2,1-3H3 |
| InChIKey | VLCKANVAVYYFIS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |