C9H11F6N3 — CID 103311299
4-tert-butyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole (PubChem CID 103311299) has the molecular formula C9H11F6N3 and a molecular weight of 275.20 g/mol. Its IUPAC name is 4-tert-butyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole.
| Compound Name | 4-tert-butyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 103311299 |
| Molecular Formula | C9H11F6N3 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-tert-butyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole |
| SMILES | CC(C)(C)n1cnnc1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11F6N3/c1-7(2,3)18-4-16-17-6(18)5(8(10,11)12)9(13,14)15/h4-5H,1-3H3 |
| InChIKey | GPOIQVROVXRKJJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |