C8H12F4N3+ — CID 91186237
1-(3-fluoropropyl)-4,5-dimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium (PubChem CID 91186237) has the molecular formula C8H12F4N3+ and a molecular weight of 226.20 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-4,5-dimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium.
| Compound Name | 1-(3-fluoropropyl)-4,5-dimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 91186237 |
| Molecular Formula | C8H12F4N3+ |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-(3-fluoropropyl)-4,5-dimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium |
| SMILES | Cc1n(CCCF)nc(C(F)(F)F)[n+]1C |
| InChI | InChI=1S/C8H12F4N3/c1-6-14(2)7(8(10,11)12)13-15(6)5-3-4-9/h3-5H2,1-2H3/q+1 |
| InChIKey | IDXLADCCDCRUPN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|