C10H12ClF6N3 — CID 103311304
4-tert-butyl-3-(chloromethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole (PubChem CID 103311304) has the molecular formula C10H12ClF6N3 and a molecular weight of 323.67 g/mol. Its IUPAC name is 4-tert-butyl-3-(chloromethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole.
| Compound Name | 4-tert-butyl-3-(chloromethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 103311304 |
| Molecular Formula | C10H12ClF6N3 |
| Molecular Weight | 323.67 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-tert-butyl-3-(chloromethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole |
| SMILES | CC(C)(C)n1c(CCl)nnc1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12ClF6N3/c1-8(2,3)20-5(4-11)18-19-7(20)6(9(12,13)14)10(15,16)17/h6H,4H2,1-3H3 |
| InChIKey | WUKZGTDDXNSHSF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.67 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|