C7H6ClF6N3 — CID 103311305
3-(chloromethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,2,4-triazole (PubChem CID 103311305) has the molecular formula C7H6ClF6N3 and a molecular weight of 281.59 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 103311305 |
| Molecular Formula | C7H6ClF6N3 |
| Molecular Weight | 281.59 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 3-(chloromethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,2,4-triazole |
| SMILES | Cn1c(CCl)nnc1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6ClF6N3/c1-17-3(2-8)15-16-5(17)4(6(9,10)11)7(12,13)14/h4H,2H2,1H3 |
| InChIKey | HSEQPLHUWDEDJF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.59 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|