C9H10BrF6N3 — CID 103311308
3-(bromomethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propan-2-yl-1,2,4-triazole (PubChem CID 103311308) has the molecular formula C9H10BrF6N3 and a molecular weight of 354.09 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 103311308 |
| Molecular Formula | C9H10BrF6N3 |
| Molecular Weight | 354.09 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 3-(bromomethyl)-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1c(CBr)nnc1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10BrF6N3/c1-4(2)19-5(3-10)17-18-7(19)6(8(11,12)13)9(14,15)16/h4,6H,3H2,1-2H3 |
| InChIKey | HDLUXNJFBSPRRG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|