C9H13F6N — CID 103312001
1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hept-6-en-3-amine (PubChem CID 103312001) has the molecular formula C9H13F6N and a molecular weight of 249.20 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hept-6-en-3-amine.
| Compound Name | 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hept-6-en-3-amine |
|---|---|
| PubChem CID | 103312001 |
| Molecular Formula | C9H13F6N |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hept-6-en-3-amine |
| SMILES | C=CCCC(NC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H13F6N/c1-3-4-5-6(16-2)7(8(10,11)12)9(13,14)15/h3,6-7,16H,1,4-5H2,2H3 |
| InChIKey | WCNBOMZFRSEPCP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|