C6H7F6N — CID 103312089
5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-amine (PubChem CID 103312089) has the molecular formula C6H7F6N and a molecular weight of 207.12 g/mol. Its IUPAC name is 5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-amine.
| Compound Name | 5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-amine |
|---|---|
| PubChem CID | 103312089 |
| Molecular Formula | C6H7F6N |
| Molecular Weight | 207.12 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-amine |
| SMILES | C=CC(N)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F6N/c1-2-3(13)4(5(7,8)9)6(10,11)12/h2-4H,1,13H2 |
| InChIKey | IONRYOCPULZAOP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.12 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|