C4H6F3N — CID 141007095
(E)-1,1,4-trifluorobut-3-en-2-amine (PubChem CID 141007095) has the molecular formula C4H6F3N and a molecular weight of 125.09 g/mol. Its IUPAC name is (E)-1,1,4-trifluorobut-3-en-2-amine.
| Compound Name | (E)-1,1,4-trifluorobut-3-en-2-amine |
|---|---|
| PubChem CID | 141007095 |
| Molecular Formula | C4H6F3N |
| Molecular Weight | 125.09 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | (E)-1,1,4-trifluorobut-3-en-2-amine |
| SMILES | NC(/C=C/F)C(F)F |
| InChI | InChI=1S/C4H6F3N/c5-2-1-3(8)4(6)7/h1-4H,8H2/b2-1+ |
| InChIKey | CQGGIPHPEPFADM-OWOJBTEDSA-N |
| XLogP | 1.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.09 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |