C12H19F6N — CID 103312115
1,1,1-trifluoro-5-methylidene-N-propyl-2-(trifluoromethyl)heptan-3-amine (PubChem CID 103312115) has the molecular formula C12H19F6N and a molecular weight of 291.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-methylidene-N-propyl-2-(trifluoromethyl)heptan-3-amine.
| Compound Name | 1,1,1-trifluoro-5-methylidene-N-propyl-2-(trifluoromethyl)heptan-3-amine |
|---|---|
| PubChem CID | 103312115 |
| Molecular Formula | C12H19F6N |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1,1,1-trifluoro-5-methylidene-N-propyl-2-(trifluoromethyl)heptan-3-amine |
| SMILES | C=C(CC)CC(NCCC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H19F6N/c1-4-6-19-9(7-8(3)5-2)10(11(13,14)15)12(16,17)18/h9-10,19H,3-7H2,1-2H3 |
| InChIKey | OIGKKMFTHFERGM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|