C16H33N — CID 105005823
3-methylidene-N,6-dipropylnonan-5-amine (PubChem CID 105005823) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 3-methylidene-N,6-dipropylnonan-5-amine.
| Compound Name | 3-methylidene-N,6-dipropylnonan-5-amine |
|---|---|
| PubChem CID | 105005823 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 3-methylidene-N,6-dipropylnonan-5-amine |
| SMILES | C=C(CC)CC(NCCC)C(CCC)CCC |
| InChI | InChI=1S/C16H33N/c1-6-10-15(11-7-2)16(17-12-8-3)13-14(5)9-4/h15-17H,5-13H2,1-4H3 |
| InChIKey | USBLCQPRTOOFJP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|