C18H37N — CID 107011617
N,4-dipropyldodec-11-en-5-amine (PubChem CID 107011617) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is N,4-dipropyldodec-11-en-5-amine.
| Compound Name | N,4-dipropyldodec-11-en-5-amine |
|---|---|
| PubChem CID | 107011617 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | N,4-dipropyldodec-11-en-5-amine |
| SMILES | C=CCCCCCC(NCCC)C(CCC)CCC |
| InChI | InChI=1S/C18H37N/c1-5-9-10-11-12-15-18(19-16-8-4)17(13-6-2)14-7-3/h5,17-19H,1,6-16H2,2-4H3 |
| InChIKey | KLXYMNBQUPCFBC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|