C12H25NO2 — CID 79493073
1,1-dimethoxy-N-propylhept-6-en-2-amine (PubChem CID 79493073) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 1,1-dimethoxy-N-propylhept-6-en-2-amine.
| Compound Name | 1,1-dimethoxy-N-propylhept-6-en-2-amine |
|---|---|
| PubChem CID | 79493073 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 1,1-dimethoxy-N-propylhept-6-en-2-amine |
| SMILES | C=CCCCC(NCCC)C(OC)OC |
| InChI | InChI=1S/C12H25NO2/c1-5-7-8-9-11(13-10-6-2)12(14-3)15-4/h5,11-13H,1,6-10H2,2-4H3 |
| InChIKey | LVNPSCZCFSZLJJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|