C8H8F6O — CID 103312449
1,1,1-trifluoro-2-(trifluoromethyl)hept-5-yn-3-ol (PubChem CID 103312449) has the molecular formula C8H8F6O and a molecular weight of 234.14 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(trifluoromethyl)hept-5-yn-3-ol.
| Compound Name | 1,1,1-trifluoro-2-(trifluoromethyl)hept-5-yn-3-ol |
|---|---|
| PubChem CID | 103312449 |
| Molecular Formula | C8H8F6O |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1,1,1-trifluoro-2-(trifluoromethyl)hept-5-yn-3-ol |
| SMILES | CC#CCC(O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6O/c1-2-3-4-5(15)6(7(9,10)11)8(12,13)14/h5-6,15H,4H2,1H3 |
| InChIKey | BWPZMQPSASSBOS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|