C6H8F6N2 — CID 103312845
[5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-yl]hydrazine (PubChem CID 103312845) has the molecular formula C6H8F6N2 and a molecular weight of 222.13 g/mol. Its IUPAC name is [5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-yl]hydrazine.
| Compound Name | [5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-yl]hydrazine |
|---|---|
| PubChem CID | 103312845 |
| Molecular Formula | C6H8F6N2 |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | [5,5,5-trifluoro-4-(trifluoromethyl)pent-1-en-3-yl]hydrazine |
| SMILES | C=CC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H8F6N2/c1-2-3(14-13)4(5(7,8)9)6(10,11)12/h2-4,14H,1,13H2 |
| InChIKey | JNRAAUSSTFUWOA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|