C7H10F6N2 — CID 103312738
[1,1,1-trifluoro-2-(trifluoromethyl)hex-5-en-3-yl]hydrazine (PubChem CID 103312738) has the molecular formula C7H10F6N2 and a molecular weight of 236.16 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-(trifluoromethyl)hex-5-en-3-yl]hydrazine.
| Compound Name | [1,1,1-trifluoro-2-(trifluoromethyl)hex-5-en-3-yl]hydrazine |
|---|---|
| PubChem CID | 103312738 |
| Molecular Formula | C7H10F6N2 |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [1,1,1-trifluoro-2-(trifluoromethyl)hex-5-en-3-yl]hydrazine |
| SMILES | C=CCC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6N2/c1-2-3-4(15-14)5(6(8,9)10)7(11,12)13/h2,4-5,15H,1,3,14H2 |
| InChIKey | RPKKNTZWQQRDEY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|