C8H12F6N2 — CID 103312851
[1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-yl]hydrazine (PubChem CID 103312851) has the molecular formula C8H12F6N2 and a molecular weight of 250.19 g/mol. Its IUPAC name is [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-yl]hydrazine.
| Compound Name | [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-yl]hydrazine |
|---|---|
| PubChem CID | 103312851 |
| Molecular Formula | C8H12F6N2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | [1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hex-5-en-3-yl]hydrazine |
| SMILES | C=C(C)CC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6N2/c1-4(2)3-5(16-15)6(7(9,10)11)8(12,13)14/h5-6,16H,1,3,15H2,2H3 |
| InChIKey | ZXHSJUVKFUBHGT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|