C9H14F6N2 — CID 103312854
[1,1,1-trifluoro-5-methylidene-2-(trifluoromethyl)heptan-3-yl]hydrazine (PubChem CID 103312854) has the molecular formula C9H14F6N2 and a molecular weight of 264.21 g/mol. Its IUPAC name is [1,1,1-trifluoro-5-methylidene-2-(trifluoromethyl)heptan-3-yl]hydrazine.
| Compound Name | [1,1,1-trifluoro-5-methylidene-2-(trifluoromethyl)heptan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103312854 |
| Molecular Formula | C9H14F6N2 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [1,1,1-trifluoro-5-methylidene-2-(trifluoromethyl)heptan-3-yl]hydrazine |
| SMILES | C=C(CC)CC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6N2/c1-3-5(2)4-6(17-16)7(8(10,11)12)9(13,14)15/h6-7,17H,2-4,16H2,1H3 |
| InChIKey | VDTSAIAMIADHGM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|