C7H12F6N2O — CID 103312857
[1-ethoxy-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine (PubChem CID 103312857) has the molecular formula C7H12F6N2O and a molecular weight of 254.17 g/mol. Its IUPAC name is [1-ethoxy-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine.
| Compound Name | [1-ethoxy-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103312857 |
| Molecular Formula | C7H12F6N2O |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [1-ethoxy-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]hydrazine |
| SMILES | CCOCC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H12F6N2O/c1-2-16-3-4(15-14)5(6(8,9)10)7(11,12)13/h4-5,15H,2-3,14H2,1H3 |
| InChIKey | AXGDICDTYLPYRE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|