C8H14F6N2O — CID 103312858
[4,4,4-trifluoro-1-propoxy-3-(trifluoromethyl)butan-2-yl]hydrazine (PubChem CID 103312858) has the molecular formula C8H14F6N2O and a molecular weight of 268.20 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-propoxy-3-(trifluoromethyl)butan-2-yl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-propoxy-3-(trifluoromethyl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103312858 |
| Molecular Formula | C8H14F6N2O |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [4,4,4-trifluoro-1-propoxy-3-(trifluoromethyl)butan-2-yl]hydrazine |
| SMILES | CCCOCC(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H14F6N2O/c1-2-3-17-4-5(16-15)6(7(9,10)11)8(12,13)14/h5-6,16H,2-4,15H2,1H3 |
| InChIKey | UXYJSLKOBULEFL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|