C9H12F6N2O — CID 103312937
[1-(3,4-dihydro-2H-pyran-6-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312937) has the molecular formula C9H12F6N2O and a molecular weight of 278.20 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-6-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-6-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103312937 |
| Molecular Formula | C9H12F6N2O |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-6-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | NNC(C1=CCCCO1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6N2O/c10-8(11,12)7(9(13,14)15)6(17-16)5-3-1-2-4-18-5/h3,6-7,17H,1-2,4,16H2 |
| InChIKey | NUFRNFZNUMXDCC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|