C9H6F3N3O — CID 10331383
5-methoxy-3-(trifluoromethyl)-1,2,4-benzotriazine (PubChem CID 10331383) has the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. Its IUPAC name is 5-methoxy-3-(trifluoromethyl)-1,2,4-benzotriazine.
| Compound Name | 5-methoxy-3-(trifluoromethyl)-1,2,4-benzotriazine |
|---|---|
| PubChem CID | 10331383 |
| Molecular Formula | C9H6F3N3O |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 5-methoxy-3-(trifluoromethyl)-1,2,4-benzotriazine |
| SMILES | COc1cccc2nnc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C9H6F3N3O/c1-16-6-4-2-3-5-7(6)13-8(15-14-5)9(10,11)12/h2-4H,1H3 |
| InChIKey | GNUHCGPTXKNDCO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |