C14H14N4OS — CID 103314511
1-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)imidazole-2-carbothioamide (PubChem CID 103314511) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)imidazole-2-carbothioamide.
| Compound Name | 1-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)imidazole-2-carbothioamide |
|---|---|
| PubChem CID | 103314511 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)imidazole-2-carbothioamide |
| SMILES | NC(=S)c1nccn1C1CCc2ccccc2NC1=O |
| InChI | InChI=1S/C14H14N4OS/c15-12(20)13-16-7-8-18(13)11-6-5-9-3-1-2-4-10(9)17-14(11)19/h1-4,7-8,11H,5-6H2,(H2,15,20)(H,17,19) |
| InChIKey | WEBFZRMFCQOTLK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|