C12H17N3O2 — CID 10331635
N-[5-[(Z)-2-ethoxyethenyl]-2,6-dimethylpyrimidin-4-yl]acetamide (PubChem CID 10331635) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[5-[(Z)-2-ethoxyethenyl]-2,6-dimethylpyrimidin-4-yl]acetamide.
| Compound Name | N-[5-[(Z)-2-ethoxyethenyl]-2,6-dimethylpyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 10331635 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-[5-[(Z)-2-ethoxyethenyl]-2,6-dimethylpyrimidin-4-yl]acetamide |
| SMILES | CCO/C=C\c1c(C)nc(C)nc1NC(C)=O |
| InChI | InChI=1S/C12H17N3O2/c1-5-17-7-6-11-8(2)13-9(3)14-12(11)15-10(4)16/h6-7H,5H2,1-4H3,(H,13,14,15,16)/b7-6- |
| InChIKey | YNUJRBFYWQZWOJ-SREVYHEPSA-N |
| XLogP | 2.06 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|