C12H11ClN2OS — CID 103320244
2-chloro-6-methyl-4-(2-methylbut-3-yn-2-yloxy)thieno[2,3-d]pyrimidine (PubChem CID 103320244) has the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. Its IUPAC name is 2-chloro-6-methyl-4-(2-methylbut-3-yn-2-yloxy)thieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-6-methyl-4-(2-methylbut-3-yn-2-yloxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103320244 |
| Molecular Formula | C12H11ClN2OS |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-chloro-6-methyl-4-(2-methylbut-3-yn-2-yloxy)thieno[2,3-d]pyrimidine |
| SMILES | C#CC(C)(C)Oc1nc(Cl)nc2sc(C)cc12 |
| InChI | InChI=1S/C12H11ClN2OS/c1-5-12(3,4)16-9-8-6-7(2)17-10(8)15-11(13)14-9/h1,6H,2-4H3 |
| InChIKey | ZTZFORKLBXDXBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|