C12H15ClN2OS — CID 103320276
2-chloro-6-methyl-4-pentan-2-yloxythieno[2,3-d]pyrimidine (PubChem CID 103320276) has the molecular formula C12H15ClN2OS and a molecular weight of 270.78 g/mol. Its IUPAC name is 2-chloro-6-methyl-4-pentan-2-yloxythieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-6-methyl-4-pentan-2-yloxythieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103320276 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-chloro-6-methyl-4-pentan-2-yloxythieno[2,3-d]pyrimidine |
| SMILES | CCCC(C)Oc1nc(Cl)nc2sc(C)cc12 |
| InChI | InChI=1S/C12H15ClN2OS/c1-4-5-7(2)16-10-9-6-8(3)17-11(9)15-12(13)14-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | VDOXMTZQWFETTC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |