C12H14ClN3OS — CID 103320724
2-chloro-N-methyl-N-(oxan-4-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103320724) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(oxan-4-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-methyl-N-(oxan-4-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103320724 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-chloro-N-methyl-N-(oxan-4-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(c1nc(Cl)nc2sccc12)C1CCOCC1 |
| InChI | InChI=1S/C12H14ClN3OS/c1-16(8-2-5-17-6-3-8)10-9-4-7-18-11(9)15-12(13)14-10/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | LSWKWDZKXYJSMJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |