C12H16N4OS — CID 103325226
4-N-methyl-4-N-(oxan-4-yl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103325226) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-N-methyl-4-N-(oxan-4-yl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-methyl-4-N-(oxan-4-yl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103325226 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-N-methyl-4-N-(oxan-4-yl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CN(c1nc(N)nc2sccc12)C1CCOCC1 |
| InChI | InChI=1S/C12H16N4OS/c1-16(8-2-5-17-6-3-8)10-9-4-7-18-11(9)15-12(13)14-10/h4,7-8H,2-3,5-6H2,1H3,(H2,13,14,15) |
| InChIKey | IGVAPOGEHDHJHV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |