C13H28O2Si — CID 10332089
5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypentan-2-one (PubChem CID 10332089) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is 5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypentan-2-one.
| Compound Name | 5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypentan-2-one |
|---|---|
| PubChem CID | 10332089 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxypentan-2-one |
| SMILES | CC(=O)CCCO[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-11(2)13(4,5)16(6,7)15-10-8-9-12(3)14/h11H,8-10H2,1-7H3 |
| InChIKey | DPEPCADQJSYIGY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|