C14H22N4S — CID 103323225
4-N,4-N-dibutylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103323225) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-N,4-N-dibutylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N,4-N-dibutylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103323225 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-N,4-N-dibutylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCCCN(CCCC)c1nc(N)nc2sccc12 |
| InChI | InChI=1S/C14H22N4S/c1-3-5-8-18(9-6-4-2)12-11-7-10-19-13(11)17-14(15)16-12/h7,10H,3-6,8-9H2,1-2H3,(H2,15,16,17) |
| InChIKey | PQUZJHBJGQCPOP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |