C15H25N5S — CID 103324349
4-N-[3-(diethylamino)propyl]-2-N,6-dimethylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103324349) has the molecular formula C15H25N5S and a molecular weight of 307.47 g/mol. Its IUPAC name is 4-N-[3-(diethylamino)propyl]-2-N,6-dimethylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(diethylamino)propyl]-2-N,6-dimethylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103324349 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-N-[3-(diethylamino)propyl]-2-N,6-dimethylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCN(CC)CCCNc1nc(NC)nc2sc(C)cc12 |
| InChI | InChI=1S/C15H25N5S/c1-5-20(6-2)9-7-8-17-13-12-10-11(3)21-14(12)19-15(16-4)18-13/h10H,5-9H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | FQZMNNFAPSLUFS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|