C14H20O2S — CID 10332467
(2R)-2-[(2R)-oxolan-2-yl]-4-phenylsulfanylbutan-2-ol (PubChem CID 10332467) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is (2R)-2-[(2R)-oxolan-2-yl]-4-phenylsulfanylbutan-2-ol.
| Compound Name | (2R)-2-[(2R)-oxolan-2-yl]-4-phenylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 10332467 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (2R)-2-[(2R)-oxolan-2-yl]-4-phenylsulfanylbutan-2-ol |
| SMILES | C[C@@](O)(CCSc1ccccc1)[C@H]1CCCO1 |
| InChI | InChI=1S/C14H20O2S/c1-14(15,13-8-5-10-16-13)9-11-17-12-6-3-2-4-7-12/h2-4,6-7,13,15H,5,8-11H2,1H3/t13-,14-/m1/s1 |
| InChIKey | LWJXXFAPEHITJE-ZIAGYGMSSA-N |
| XLogP | 3.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |