C17H18O2 — CID 10332544
(10E)-10-(furan-2-ylmethylidene)tricyclo[6.3.1.01,6]dodec-5-en-9-one (PubChem CID 10332544) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (10E)-10-(furan-2-ylmethylidene)tricyclo[6.3.1.01,6]dodec-5-en-9-one.
| Compound Name | (10E)-10-(furan-2-ylmethylidene)tricyclo[6.3.1.01,6]dodec-5-en-9-one |
|---|---|
| PubChem CID | 10332544 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (10E)-10-(furan-2-ylmethylidene)tricyclo[6.3.1.01,6]dodec-5-en-9-one |
| SMILES | O=C1/C(=C/c2ccco2)CC23CCCC=C2CC1C3 |
| InChI | InChI=1S/C17H18O2/c18-16-12-8-14-4-1-2-6-17(14,10-12)11-13(16)9-15-5-3-7-19-15/h3-5,7,9,12H,1-2,6,8,10-11H2/b13-9+ |
| InChIKey | HUVCLKMRTIFIMN-UKTHLTGXSA-N |
| XLogP | 4.14 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|