C12H17NO3S — CID 10332604
2-(benzenesulfonyl)-N,N-diethylacetamide (PubChem CID 10332604) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N,N-diethylacetamide.
| Compound Name | 2-(benzenesulfonyl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 10332604 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(benzenesulfonyl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO3S/c1-3-13(4-2)12(14)10-17(15,16)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | KEAACMAWBWZGJR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |