C13H20N4OS — CID 103329690
4-[(2-amino-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-2-ol (PubChem CID 103329690) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-[(2-amino-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-2-ol.
| Compound Name | 4-[(2-amino-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 103329690 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-[(2-amino-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-2-ol |
| SMILES | CCc1cc2c(NC(C)CC(C)O)nc(N)nc2s1 |
| InChI | InChI=1S/C13H20N4OS/c1-4-9-6-10-11(15-7(2)5-8(3)18)16-13(14)17-12(10)19-9/h6-8,18H,4-5H2,1-3H3,(H3,14,15,16,17) |
| InChIKey | JXLBXBJPGYGONR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |